C22H30O4S — CID 11269313
[(1S,3aR,4R,7S,7aR)-1,4-dimethyl-5-oxo-7-prop-1-en-2-yl-2,3,3a,6,7,7a-hexahydro-1H-inden-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11269313) has the molecular formula C22H30O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is [(1S,3aR,4R,7S,7aR)-1,4-dimethyl-5-oxo-7-prop-1-en-2-yl-2,3,3a,6,7,7a-hexahydro-1H-inden-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,3aR,4R,7S,7aR)-1,4-dimethyl-5-oxo-7-prop-1-en-2-yl-2,3,3a,6,7,7a-hexahydro-1H-inden-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11269313 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [(1S,3aR,4R,7S,7aR)-1,4-dimethyl-5-oxo-7-prop-1-en-2-yl-2,3,3a,6,7,7a-hexahydro-1H-inden-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C=C(C)[C@H]1CC(=O)[C@@](C)(COS(=O)(=O)c2ccc(C)cc2)[C@@H]2CC[C@H](C)[C@H]12 |
| InChI | InChI=1S/C22H30O4S/c1-14(2)18-12-20(23)22(5,19-11-8-16(4)21(18)19)13-26-27(24,25)17-9-6-15(3)7-10-17/h6-7,9-10,16,18-19,21H,1,8,11-13H2,2-5H3/t16-,18+,19+,21+,22-/m0/s1 |
| InChIKey | XZUXJHOKMVNTBF-ZNSCVOQBSA-N |
| XLogP | 4.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|