C24H23ClN2O — CID 11269330
(6aS,13bS)-11-chloro-7-methyl-4-pyridin-4-yl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol (PubChem CID 11269330) has the molecular formula C24H23ClN2O and a molecular weight of 390.91 g/mol. Its IUPAC name is (6aS,13bS)-11-chloro-7-methyl-4-pyridin-4-yl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol.
| Compound Name | (6aS,13bS)-11-chloro-7-methyl-4-pyridin-4-yl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol |
|---|---|
| PubChem CID | 11269330 |
| Molecular Formula | C24H23ClN2O |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (6aS,13bS)-11-chloro-7-methyl-4-pyridin-4-yl-5,6,6a,8,9,13b-hexahydronaphtho[1,2-a][3]benzazepin-12-ol |
| SMILES | CN1CCc2cc(Cl)c(O)cc2[C@H]2c3cccc(-c4ccncc4)c3CC[C@@H]21 |
| InChI | InChI=1S/C24H23ClN2O/c1-27-12-9-16-13-21(25)23(28)14-20(16)24-19-4-2-3-17(15-7-10-26-11-8-15)18(19)5-6-22(24)27/h2-4,7-8,10-11,13-14,22,24,28H,5-6,9,12H2,1H3/t22-,24+/m0/s1 |
| InChIKey | OPAOHONEUXVLNP-LADGPHEKSA-N |
| XLogP | 5.04 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |