C16H36O5Si3 — CID 11269385
[(2S,3S,4S,5S)-2-methoxy-6-methylidene-3,5-bis(trimethylsilyloxy)oxan-4-yl]oxy-trimethylsilane (PubChem CID 11269385) has the molecular formula C16H36O5Si3 and a molecular weight of 392.72 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-2-methoxy-6-methylidene-3,5-bis(trimethylsilyloxy)oxan-4-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3S,4S,5S)-2-methoxy-6-methylidene-3,5-bis(trimethylsilyloxy)oxan-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11269385 |
| Molecular Formula | C16H36O5Si3 |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [(2S,3S,4S,5S)-2-methoxy-6-methylidene-3,5-bis(trimethylsilyloxy)oxan-4-yl]oxy-trimethylsilane |
| SMILES | C=C1O[C@H](OC)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C16H36O5Si3/c1-12-13(19-22(3,4)5)14(20-23(6,7)8)15(16(17-2)18-12)21-24(9,10)11/h13-16H,1H2,2-11H3/t13-,14+,15+,16+/m1/s1 |
| InChIKey | KRQMBDHCXVDVRL-UGUYLWEFSA-N |
| XLogP | 4.16 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|