C20H21ClO6 — CID 11269387
(4R,6R,8R,9Z,11E)-16-chloro-17,19-dimethoxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene-2,13-dione (PubChem CID 11269387) has the molecular formula C20H21ClO6 and a molecular weight of 392.84 g/mol. Its IUPAC name is (4R,6R,8R,9Z,11E)-16-chloro-17,19-dimethoxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene-2,13-dione.
| Compound Name | (4R,6R,8R,9Z,11E)-16-chloro-17,19-dimethoxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene-2,13-dione |
|---|---|
| PubChem CID | 11269387 |
| Molecular Formula | C20H21ClO6 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (4R,6R,8R,9Z,11E)-16-chloro-17,19-dimethoxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(15),9,11,16,18-pentaene-2,13-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)CC(=O)/C=C/C=C/[C@H]1O[C@@H]1C[C@@H](C)OC2=O |
| InChI | InChI=1S/C20H21ClO6/c1-11-8-15-14(27-15)7-5-4-6-12(22)9-13-18(20(23)26-11)16(24-2)10-17(25-3)19(13)21/h4-7,10-11,14-15H,8-9H2,1-3H3/b6-4+,7-5+/t11-,14-,15-/m1/s1 |
| InChIKey | IXYWHKVYGVAWAE-WWUULAEOSA-N |
| XLogP | 3.30 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|