C12H10FNO2S — CID 112693890
2-[4-(2-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]acetic acid (PubChem CID 112693890) has the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]acetic acid.
| Compound Name | 2-[4-(2-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 112693890 |
| Molecular Formula | C12H10FNO2S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-[4-(2-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]acetic acid |
| SMILES | Cc1sc(CC(=O)O)nc1-c1ccccc1F |
| InChI | InChI=1S/C12H10FNO2S/c1-7-12(8-4-2-3-5-9(8)13)14-10(17-7)6-11(15)16/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | YVOLMVQVQLPBRY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |