C16H15F4NO4S — CID 11269393
(1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 11269393) has the molecular formula C16H15F4NO4S and a molecular weight of 393.36 g/mol. Its IUPAC name is (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 11269393 |
| Molecular Formula | C16H15F4NO4S |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[[3-(trifluoromethyl)phenyl]methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | N[C@]1(C(=O)O)[C@H]2[C@@H](C[C@H]1SCc1cccc(C(F)(F)F)c1)[C@]2(F)C(=O)O |
| InChI | InChI=1S/C16H15F4NO4S/c17-14(12(22)23)9-5-10(15(21,11(9)14)13(24)25)26-6-7-2-1-3-8(4-7)16(18,19)20/h1-4,9-11H,5-6,21H2,(H,22,23)(H,24,25)/t9-,10-,11+,14-,15+/m1/s1 |
| InChIKey | XZRRGPPXWYQEBM-ZNLHFFCSSA-N |
| XLogP | 2.53 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |