C21H36O5Si — CID 11269486
ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,3R)-3-formyloxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate (PubChem CID 11269486) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,3R)-3-formyloxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,3R)-3-formyloxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 11269486 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | ethyl (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,3R)-3-formyloxiran-2-yl]-2,4,6-trimethylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C(C)=C/[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1C=O |
| InChI | InChI=1S/C21H36O5Si/c1-10-24-20(23)16(4)12-14(2)11-15(3)18(19-17(13-22)25-19)26-27(8,9)21(5,6)7/h11-13,15,17-19H,10H2,1-9H3/b14-11+,16-12+/t15-,17+,18+,19-/m1/s1 |
| InChIKey | YUEMMZJCNZOETQ-OBWYJHQCSA-N |
| XLogP | 4.43 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|