C10H8F6INO — CID 11269545
2-(2-amino-3-iodo-5-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11269545) has the molecular formula C10H8F6INO and a molecular weight of 399.07 g/mol. Its IUPAC name is 2-(2-amino-3-iodo-5-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2-amino-3-iodo-5-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11269545 |
| Molecular Formula | C10H8F6INO |
| Molecular Weight | 399.07 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 2-(2-amino-3-iodo-5-methylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1cc(I)c(N)c(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F6INO/c1-4-2-5(7(18)6(17)3-4)8(19,9(11,12)13)10(14,15)16/h2-3,19H,18H2,1H3 |
| InChIKey | LTPZEFZHNDNLMQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.07 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|