About 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine
4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine (PubChem CID 112695724) has the molecular formula C9H12F3N3O
and a molecular weight of 235.21 g/mol. Its IUPAC name is 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine |
| PubChem CID | 112695724 |
| Molecular Formula | C9H12F3N3O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine |
| SMILES | COc1ccnc(NCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N3O/c1-16-7-3-6-14-8(15-7)13-5-2-4-9(10,11)12/h3,6H,2,4-5H2,1H3,(H,13,14,15) |
| InChIKey | MLRQAILYSARVJA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine?
The IUPAC name of 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine (CID 112695724) is 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine.
What is the SMILES notation for 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine?
The canonical SMILES for 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine is COc1ccnc(NCCCC(F)(F)F)n1.
What is the InChIKey of 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine?
The InChIKey is MLRQAILYSARVJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3O/c1-16-7-3-6-14-8(15-7)13-5-2-4-9(10,11)12/h3,6H,2,4-5H2,1H3,(H,13,14,15).
What are the key properties of 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine?
4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine has a molecular weight of 235.21 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N-(4,4,4-trifluorobutyl)pyrimidin-2-amine is sourced from PubChem (CID 112695724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).