C7H16N2O2S — CID 112696450
1,1,2,2-tetramethyl-3-(sulfamoylamino)cyclopropane (PubChem CID 112696450) has the molecular formula C7H16N2O2S and a molecular weight of 192.28 g/mol. Its IUPAC name is 1,1,2,2-tetramethyl-3-(sulfamoylamino)cyclopropane.
| Compound Name | 1,1,2,2-tetramethyl-3-(sulfamoylamino)cyclopropane |
|---|---|
| PubChem CID | 112696450 |
| Molecular Formula | C7H16N2O2S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1,1,2,2-tetramethyl-3-(sulfamoylamino)cyclopropane |
| SMILES | CC1(C)C(NS(N)(=O)=O)C1(C)C |
| InChI | InChI=1S/C7H16N2O2S/c1-6(2)5(7(6,3)4)9-12(8,10)11/h5,9H,1-4H3,(H2,8,10,11) |
| InChIKey | FHYOHBPNZPUIED-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |