C13H23N3O3 — CID 112697491
methyl 2-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)hexanoate (PubChem CID 112697491) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl 2-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)hexanoate.
| Compound Name | methyl 2-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)hexanoate |
|---|---|
| PubChem CID | 112697491 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | methyl 2-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)hexanoate |
| SMILES | CCCCC(C(=O)OC)N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C13H23N3O3/c1-3-4-5-11(12(17)19-2)15-6-7-16-10(9-15)8-14-13(16)18/h10-11H,3-9H2,1-2H3,(H,14,18) |
| InChIKey | QUOAZOFEZQFGTM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |