C10H22N2O3S — CID 112698309
3-[2-(cyclopropylmethoxy)ethyl-methylamino]propane-1-sulfonamide (PubChem CID 112698309) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is 3-[2-(cyclopropylmethoxy)ethyl-methylamino]propane-1-sulfonamide.
| Compound Name | 3-[2-(cyclopropylmethoxy)ethyl-methylamino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 112698309 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-[2-(cyclopropylmethoxy)ethyl-methylamino]propane-1-sulfonamide |
| SMILES | CN(CCCS(N)(=O)=O)CCOCC1CC1 |
| InChI | InChI=1S/C10H22N2O3S/c1-12(5-2-8-16(11,13)14)6-7-15-9-10-3-4-10/h10H,2-9H2,1H3,(H2,11,13,14) |
| InChIKey | JAUYOYVFFOLXCH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|