About 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea
1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea (PubChem CID 112699973) has the molecular formula C9H15F3N2O2
and a molecular weight of 240.22 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea |
| PubChem CID | 112699973 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea |
| SMILES | O=C(NOCC(F)(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C9H15F3N2O2/c10-9(11,12)6-16-14-8(15)13-7-4-2-1-3-5-7/h7H,1-6H2,(H2,13,14,15) |
| InChIKey | YROGYCJAADPXGK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea?
The IUPAC name of 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea (CID 112699973) is 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea.
What is the SMILES notation for 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea?
The canonical SMILES for 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea is O=C(NOCC(F)(F)F)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea?
The InChIKey is YROGYCJAADPXGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O2/c10-9(11,12)6-16-14-8(15)13-7-4-2-1-3-5-7/h7H,1-6H2,(H2,13,14,15).
What are the key properties of 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea?
1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea has a molecular weight of 240.22 g/mol, XLogP of 2.11, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-(2,2,2-trifluoroethoxy)urea is sourced from PubChem (CID 112699973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).