C16H23N3 — CID 112700053
N-[1-(2,5-dimethylphenyl)ethyl]-3-pyrazol-1-ylpropan-1-amine (PubChem CID 112700053) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-[1-(2,5-dimethylphenyl)ethyl]-3-pyrazol-1-ylpropan-1-amine.
| Compound Name | N-[1-(2,5-dimethylphenyl)ethyl]-3-pyrazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 112700053 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-[1-(2,5-dimethylphenyl)ethyl]-3-pyrazol-1-ylpropan-1-amine |
| SMILES | Cc1ccc(C)c(C(C)NCCCn2cccn2)c1 |
| InChI | InChI=1S/C16H23N3/c1-13-6-7-14(2)16(12-13)15(3)17-8-4-10-19-11-5-9-18-19/h5-7,9,11-12,15,17H,4,8,10H2,1-3H3 |
| InChIKey | OACTURSVFRMPDG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|