C12H18FNO3 — CID 112700459
2-[1-(2-fluoro-6-methoxyphenyl)ethylamino]propane-1,3-diol (PubChem CID 112700459) has the molecular formula C12H18FNO3 and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-[1-(2-fluoro-6-methoxyphenyl)ethylamino]propane-1,3-diol.
| Compound Name | 2-[1-(2-fluoro-6-methoxyphenyl)ethylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 112700459 |
| Molecular Formula | C12H18FNO3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-[1-(2-fluoro-6-methoxyphenyl)ethylamino]propane-1,3-diol |
| SMILES | COc1cccc(F)c1C(C)NC(CO)CO |
| InChI | InChI=1S/C12H18FNO3/c1-8(14-9(6-15)7-16)12-10(13)4-3-5-11(12)17-2/h3-5,8-9,14-16H,6-7H2,1-2H3 |
| InChIKey | VEFNHWBCMDFZND-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |