C25H41NO4 — CID 11270088
(4S,6S)-3-benzyl-4-(3,3-dimethoxypropyl)-6-nonyl-1,3-oxazinan-2-one (PubChem CID 11270088) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is (4S,6S)-3-benzyl-4-(3,3-dimethoxypropyl)-6-nonyl-1,3-oxazinan-2-one.
| Compound Name | (4S,6S)-3-benzyl-4-(3,3-dimethoxypropyl)-6-nonyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 11270088 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | (4S,6S)-3-benzyl-4-(3,3-dimethoxypropyl)-6-nonyl-1,3-oxazinan-2-one |
| SMILES | CCCCCCCCC[C@H]1C[C@H](CCC(OC)OC)N(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C25H41NO4/c1-4-5-6-7-8-9-13-16-23-19-22(17-18-24(28-2)29-3)26(25(27)30-23)20-21-14-11-10-12-15-21/h10-12,14-15,22-24H,4-9,13,16-20H2,1-3H3/t22-,23-/m0/s1 |
| InChIKey | MTPALJFIRATOPX-GOTSBHOMSA-N |
| XLogP | 6.31 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|