C12H14F4N2O — CID 112701403
N-(1-aminopropan-2-yl)-2-fluoro-N-methyl-3-(trifluoromethyl)benzamide (PubChem CID 112701403) has the molecular formula C12H14F4N2O and a molecular weight of 278.25 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-2-fluoro-N-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-(1-aminopropan-2-yl)-2-fluoro-N-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 112701403 |
| Molecular Formula | C12H14F4N2O |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N-(1-aminopropan-2-yl)-2-fluoro-N-methyl-3-(trifluoromethyl)benzamide |
| SMILES | CC(CN)N(C)C(=O)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C12H14F4N2O/c1-7(6-17)18(2)11(19)8-4-3-5-9(10(8)13)12(14,15)16/h3-5,7H,6,17H2,1-2H3 |
| InChIKey | UKTXMKMJAZODAM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |