C12H10FNO2S — CID 112703041
1-[3-fluoro-4-(1,3-thiazol-2-ylmethoxy)phenyl]ethanone (PubChem CID 112703041) has the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. Its IUPAC name is 1-[3-fluoro-4-(1,3-thiazol-2-ylmethoxy)phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-(1,3-thiazol-2-ylmethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 112703041 |
| Molecular Formula | C12H10FNO2S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 1-[3-fluoro-4-(1,3-thiazol-2-ylmethoxy)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCc2nccs2)c(F)c1 |
| InChI | InChI=1S/C12H10FNO2S/c1-8(15)9-2-3-11(10(13)6-9)16-7-12-14-4-5-17-12/h2-6H,7H2,1H3 |
| InChIKey | YTMDRNLYNHXMBV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |