C11H14FN3O2 — CID 112703198
methyl 1-(5-fluoropyrimidin-2-yl)-4-methylpyrrolidine-3-carboxylate (PubChem CID 112703198) has the molecular formula C11H14FN3O2 and a molecular weight of 239.25 g/mol. Its IUPAC name is methyl 1-(5-fluoropyrimidin-2-yl)-4-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(5-fluoropyrimidin-2-yl)-4-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 112703198 |
| Molecular Formula | C11H14FN3O2 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | methyl 1-(5-fluoropyrimidin-2-yl)-4-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(c2ncc(F)cn2)CC1C |
| InChI | InChI=1S/C11H14FN3O2/c1-7-5-15(6-9(7)10(16)17-2)11-13-3-8(12)4-14-11/h3-4,7,9H,5-6H2,1-2H3 |
| InChIKey | SWYRZJRJQGCHRF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |