About 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide
3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide (PubChem CID 11270327) has the molecular formula C22H25ClN4OS
and a molecular weight of 428.99 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide |
| PubChem CID | 11270327 |
| Molecular Formula | C22H25ClN4OS |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide |
| SMILES | CCCCCCSc1nc(-c2ccc(Cl)cc2)nn1C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C22H25ClN4OS/c1-3-4-5-9-16-29-21-24-20(17-12-14-18(23)15-13-17)25-27(21)22(28)26(2)19-10-7-6-8-11-19/h6-8,10-15H,3-5,9,16H2,1-2H3 |
| InChIKey | ZXFMPWBMCUITTN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide?
The IUPAC name of 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide (CID 11270327) is 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide.
What is the SMILES notation for 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide?
The canonical SMILES for 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide is CCCCCCSc1nc(-c2ccc(Cl)cc2)nn1C(=O)N(C)c1ccccc1.
What is the InChIKey of 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide?
The InChIKey is ZXFMPWBMCUITTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25ClN4OS/c1-3-4-5-9-16-29-21-24-20(17-12-14-18(23)15-13-17)25-27(21)22(28)26(2)19-10-7-6-8-11-19/h6-8,10-15H,3-5,9,16H2,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide?
3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide has a molecular weight of 428.99 g/mol, XLogP of 6.38, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-5-hexylsulfanyl-N-methyl-N-phenyl-1,2,4-triazole-1-carboxamide is sourced from PubChem (CID 11270327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).