C13H25N3O9P2 — CID 11270329
(1-hydroxy-1-phosphono-2-pyridin-3-ylethyl)phosphonic acid;2-(morpholin-4-ylamino)ethanol (PubChem CID 11270329) has the molecular formula C13H25N3O9P2 and a molecular weight of 429.30 g/mol. Its IUPAC name is (1-hydroxy-1-phosphono-2-pyridin-3-ylethyl)phosphonic acid;2-(morpholin-4-ylamino)ethanol.
| Compound Name | (1-hydroxy-1-phosphono-2-pyridin-3-ylethyl)phosphonic acid;2-(morpholin-4-ylamino)ethanol |
|---|---|
| PubChem CID | 11270329 |
| Molecular Formula | C13H25N3O9P2 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (1-hydroxy-1-phosphono-2-pyridin-3-ylethyl)phosphonic acid;2-(morpholin-4-ylamino)ethanol |
| SMILES | O=P(O)(O)C(O)(Cc1cccnc1)P(=O)(O)O.OCCNN1CCOCC1 |
| InChI | InChI=1S/C7H11NO7P2.C6H14N2O2/c9-7(16(10,11)12,17(13,14)15)4-6-2-1-3-8-5-6;9-4-1-7-8-2-5-10-6-3-8/h1-3,5,9H,4H2,(H2,10,11,12)(H2,13,14,15);7,9H,1-6H2 |
| InChIKey | AAXZOIUKTHSUPN-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 192.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|