C19H16ClN5O3S — CID 11270352
8-chloro-4-[(1-methylindazol-6-yl)amino]-6-methylsulfonylquinoline-3-carboxamide (PubChem CID 11270352) has the molecular formula C19H16ClN5O3S and a molecular weight of 429.89 g/mol. Its IUPAC name is 8-chloro-4-[(1-methylindazol-6-yl)amino]-6-methylsulfonylquinoline-3-carboxamide.
| Compound Name | 8-chloro-4-[(1-methylindazol-6-yl)amino]-6-methylsulfonylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11270352 |
| Molecular Formula | C19H16ClN5O3S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 8-chloro-4-[(1-methylindazol-6-yl)amino]-6-methylsulfonylquinoline-3-carboxamide |
| SMILES | Cn1ncc2ccc(Nc3c(C(N)=O)cnc4c(Cl)cc(S(C)(=O)=O)cc34)cc21 |
| InChI | InChI=1S/C19H16ClN5O3S/c1-25-16-5-11(4-3-10(16)8-23-25)24-17-13-6-12(29(2,27)28)7-15(20)18(13)22-9-14(17)19(21)26/h3-9H,1-2H3,(H2,21,26)(H,22,24) |
| InChIKey | RLDRCWMAJXSAQY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |