About 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine
2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine (PubChem CID 11270377) has the molecular formula C24H34N2O3S
and a molecular weight of 430.61 g/mol. Its IUPAC name is 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine |
| PubChem CID | 11270377 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc2c(c1)S(=O)c1cc(OCCN(CC)CC)ccc1-2 |
| InChI | InChI=1S/C24H34N2O3S/c1-5-25(6-2)13-15-28-19-9-11-21-22-12-10-20(29-16-14-26(7-3)8-4)18-24(22)30(27)23(21)17-19/h9-12,17-18H,5-8,13-16H2,1-4H3 |
| InChIKey | UJARZWVISDTJTE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine?
The IUPAC name of 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine (CID 11270377) is 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine.
What is the SMILES notation for 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine?
The canonical SMILES for 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine is CCN(CC)CCOc1ccc2c(c1)S(=O)c1cc(OCCN(CC)CC)ccc1-2.
What is the InChIKey of 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine?
The InChIKey is UJARZWVISDTJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N2O3S/c1-5-25(6-2)13-15-28-19-9-11-21-22-12-10-20(29-16-14-26(7-3)8-4)18-24(22)30(27)23(21)17-19/h9-12,17-18H,5-8,13-16H2,1-4H3.
What are the key properties of 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine?
2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine has a molecular weight of 430.61 g/mol, XLogP of 4.27, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-[2-(diethylamino)ethoxy]-5-oxodibenzothiophen-3-yl]oxy-N,N-diethylethanamine is sourced from PubChem (CID 11270377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).