C11H18N2 — CID 112704132
2-(1-aminopropyl)-N,N-dimethylaniline (PubChem CID 112704132) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-(1-aminopropyl)-N,N-dimethylaniline.
| Compound Name | 2-(1-aminopropyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 112704132 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-(1-aminopropyl)-N,N-dimethylaniline |
| SMILES | CCC(N)c1ccccc1N(C)C |
| InChI | InChI=1S/C11H18N2/c1-4-10(12)9-7-5-6-8-11(9)13(2)3/h5-8,10H,4,12H2,1-3H3 |
| InChIKey | FUIXHJJIMBBWKS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |