C11H15BrClN — CID 112705508
1-(4-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-amine (PubChem CID 112705508) has the molecular formula C11H15BrClN and a molecular weight of 276.61 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-amine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 112705508 |
| Molecular Formula | C11H15BrClN |
| Molecular Weight | 276.61 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)C(N)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C11H15BrClN/c1-11(2,3)10(14)8-5-4-7(12)6-9(8)13/h4-6,10H,14H2,1-3H3 |
| InChIKey | JKHZVMRZSINZQD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |