C12H13BrN2S — CID 112706350
[2-(2-bromophenyl)-4-ethyl-1,3-thiazol-5-yl]methanamine (PubChem CID 112706350) has the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. Its IUPAC name is [2-(2-bromophenyl)-4-ethyl-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-(2-bromophenyl)-4-ethyl-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 112706350 |
| Molecular Formula | C12H13BrN2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | [2-(2-bromophenyl)-4-ethyl-1,3-thiazol-5-yl]methanamine |
| SMILES | CCc1nc(-c2ccccc2Br)sc1CN |
| InChI | InChI=1S/C12H13BrN2S/c1-2-10-11(7-14)16-12(15-10)8-5-3-4-6-9(8)13/h3-6H,2,7,14H2,1H3 |
| InChIKey | GMFJDHWRMOQFQJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |