C19H21BrN2O3S — CID 1127069
N-benzyl-4-bromo-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 1127069) has the molecular formula C19H21BrN2O3S and a molecular weight of 437.36 g/mol. Its IUPAC name is N-benzyl-4-bromo-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-benzyl-4-bromo-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 1127069 |
| Molecular Formula | C19H21BrN2O3S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-benzyl-4-bromo-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(Br)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H21BrN2O3S/c20-17-10-9-16(19(23)21-14-15-7-3-1-4-8-15)13-18(17)26(24,25)22-11-5-2-6-12-22/h1,3-4,7-10,13H,2,5-6,11-12,14H2,(H,21,23) |
| InChIKey | ICVNKBWPQVVXBS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |