About 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole
4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole (PubChem CID 112707186) has the molecular formula C12H17N3S
and a molecular weight of 235.36 g/mol. Its IUPAC name is 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole.
Molecular Properties
| Compound Name | 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole |
| PubChem CID | 112707186 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole |
| SMILES | Cc1ccc(C)n1CCSc1cnn(C)c1 |
| InChI | InChI=1S/C12H17N3S/c1-10-4-5-11(2)15(10)6-7-16-12-8-13-14(3)9-12/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | RBMHFWUSDYGUQL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole?
The IUPAC name of 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole (CID 112707186) is 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole.
What is the SMILES notation for 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole?
The canonical SMILES for 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole is Cc1ccc(C)n1CCSc1cnn(C)c1.
What is the InChIKey of 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole?
The InChIKey is RBMHFWUSDYGUQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3S/c1-10-4-5-11(2)15(10)6-7-16-12-8-13-14(3)9-12/h4-5,8-9H,6-7H2,1-3H3.
What are the key properties of 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole?
4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole has a molecular weight of 235.36 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,5-dimethylpyrrol-1-yl)ethylsulfanyl]-1-methylpyrazole is sourced from PubChem (CID 112707186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).