About 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid
2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid (PubChem CID 112707617) has the molecular formula C14H12BrN3O3
and a molecular weight of 350.17 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid |
| PubChem CID | 112707617 |
| Molecular Formula | C14H12BrN3O3 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid |
| SMILES | O=C(O)CN1CCn2nc(-c3cccc(Br)c3)cc2C1=O |
| InChI | InChI=1S/C14H12BrN3O3/c15-10-3-1-2-9(6-10)11-7-12-14(21)17(8-13(19)20)4-5-18(12)16-11/h1-3,6-7H,4-5,8H2,(H,19,20) |
| InChIKey | PSEIICCFMYQZRZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid?
The IUPAC name of 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid (CID 112707617) is 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid.
What is the SMILES notation for 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid?
The canonical SMILES for 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid is O=C(O)CN1CCn2nc(-c3cccc(Br)c3)cc2C1=O.
What is the InChIKey of 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid?
The InChIKey is PSEIICCFMYQZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrN3O3/c15-10-3-1-2-9(6-10)11-7-12-14(21)17(8-13(19)20)4-5-18(12)16-11/h1-3,6-7H,4-5,8H2,(H,19,20).
What are the key properties of 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid?
2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid has a molecular weight of 350.17 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-bromophenyl)-4-oxo-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetic acid is sourced from PubChem (CID 112707617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).