About 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole
2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole (PubChem CID 112708516) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole |
| PubChem CID | 112708516 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole |
| SMILES | C1CNCCN(C2=NCCS2)C1 |
| InChI | InChI=1S/C8H15N3S/c1-2-9-3-6-11(5-1)8-10-4-7-12-8/h9H,1-7H2 |
| InChIKey | GABBGFAIYQCXBI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole (CID 112708516) is 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole is C1CNCCN(C2=NCCS2)C1.
What is the InChIKey of 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole?
The InChIKey is GABBGFAIYQCXBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-2-9-3-6-11(5-1)8-10-4-7-12-8/h9H,1-7H2.
What are the key properties of 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole?
2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole has a molecular weight of 185.30 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-yl)-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 112708516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).