About tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane
tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane (PubChem CID 11270883) has the molecular formula C16H19Br2ClOSi
and a molecular weight of 450.67 g/mol. Its IUPAC name is tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane |
| PubChem CID | 11270883 |
| Molecular Formula | C16H19Br2ClOSi |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 447.93 |
| IUPAC Name | tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc2c(Cl)cc(Br)cc2cc1Br |
| InChI | InChI=1S/C16H19Br2ClOSi/c1-16(2,3)21(4,5)20-15-9-12-10(7-13(15)18)6-11(17)8-14(12)19/h6-9H,1-5H3 |
| InChIKey | ADBNMUAXSPOANR-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane?
The IUPAC name of tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane (CID 11270883) is tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane?
The canonical SMILES for tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane is CC(C)(C)[Si](C)(C)Oc1cc2c(Cl)cc(Br)cc2cc1Br.
What is the InChIKey of tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane?
The InChIKey is ADBNMUAXSPOANR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Br2ClOSi/c1-16(2,3)21(4,5)20-15-9-12-10(7-13(15)18)6-11(17)8-14(12)19/h6-9H,1-5H3.
What are the key properties of tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane?
tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane has a molecular weight of 450.67 g/mol, XLogP of 7.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(3,6-dibromo-8-chloronaphthalen-2-yl)oxy-dimethylsilane is sourced from PubChem (CID 11270883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).