7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid

C12H15NO2 — CID 112709090

IUPAC7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid
SMILESCN(C)c1cccc2c1C(C(=O)O)CC2
InChIInChI=1S/C12H15NO2/c1-13(2)10-5-3-4-8-6-7-9(11(8)10)12(14)15/h3-5,9H,6-7H2,1-2H3,(H,14,15)
InChIKeyBDRGAXRJTLKZNU-UHFFFAOYSA-N
MW205.26 g/mol
LogP1.87
Rot. Bonds2

About 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid

7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid (PubChem CID 112709090) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid.

Molecular Properties

Compound Name7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid
PubChem CID112709090
Molecular FormulaC12H15NO2
Molecular Weight205.26 g/mol
Exact Mass205.11
IUPAC Name7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid
SMILESCN(C)c1cccc2c1C(C(=O)O)CC2
InChIInChI=1S/C12H15NO2/c1-13(2)10-5-3-4-8-6-7-9(11(8)10)12(14)15/h3-5,9H,6-7H2,1-2H3,(H,14,15)
InChIKeyBDRGAXRJTLKZNU-UHFFFAOYSA-N
XLogP1.87
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid?
The IUPAC name of 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid (CID 112709090) is 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid.
What is the SMILES notation for 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid?
The canonical SMILES for 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid is CN(C)c1cccc2c1C(C(=O)O)CC2.
What is the InChIKey of 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid?
The InChIKey is BDRGAXRJTLKZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-13(2)10-5-3-4-8-6-7-9(11(8)10)12(14)15/h3-5,9H,6-7H2,1-2H3,(H,14,15).
What are the key properties of 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid?
7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid has a molecular weight of 205.26 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(dimethylamino)-2,3-dihydro-1H-indene-1-carboxylic acid is sourced from PubChem (CID 112709090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).