About (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate
(3-methyl-4-propan-2-ylphenyl) N-aminocarbamate (PubChem CID 112709148) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate.
Molecular Properties
| Compound Name | (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate |
| PubChem CID | 112709148 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate |
| SMILES | Cc1cc(OC(=O)NN)ccc1C(C)C |
| InChI | InChI=1S/C11H16N2O2/c1-7(2)10-5-4-9(6-8(10)3)15-11(14)13-12/h4-7H,12H2,1-3H3,(H,13,14) |
| InChIKey | NLOWKSVFNDCKQQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate?
The IUPAC name of (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate (CID 112709148) is (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate.
What is the SMILES notation for (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate?
The canonical SMILES for (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate is Cc1cc(OC(=O)NN)ccc1C(C)C.
What is the InChIKey of (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate?
The InChIKey is NLOWKSVFNDCKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-7(2)10-5-4-9(6-8(10)3)15-11(14)13-12/h4-7H,12H2,1-3H3,(H,13,14).
What are the key properties of (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate?
(3-methyl-4-propan-2-ylphenyl) N-aminocarbamate has a molecular weight of 208.26 g/mol, XLogP of 2.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-4-propan-2-ylphenyl) N-aminocarbamate is sourced from PubChem (CID 112709148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).