About (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine
(1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine (PubChem CID 112709575) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine.
Molecular Properties
| Compound Name | (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine |
| PubChem CID | 112709575 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine |
| SMILES | Cc1cccc2c1C(CN)CCN2C |
| InChI | InChI=1S/C12H18N2/c1-9-4-3-5-11-12(9)10(8-13)6-7-14(11)2/h3-5,10H,6-8,13H2,1-2H3 |
| InChIKey | SPILZUUUPSGWHH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine?
The IUPAC name of (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine (CID 112709575) is (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine.
What is the SMILES notation for (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine?
The canonical SMILES for (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine is Cc1cccc2c1C(CN)CCN2C.
What is the InChIKey of (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine?
The InChIKey is SPILZUUUPSGWHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-9-4-3-5-11-12(9)10(8-13)6-7-14(11)2/h3-5,10H,6-8,13H2,1-2H3.
What are the key properties of (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine?
(1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine has a molecular weight of 190.29 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,5-dimethyl-3,4-dihydro-2H-quinolin-4-yl)methanamine is sourced from PubChem (CID 112709575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).