C11H18N2O — CID 112709702
1,2-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-3-amine (PubChem CID 112709702) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1,2-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-3-amine.
| Compound Name | 1,2-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 112709702 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1,2-dimethyl-2-(5-methylfuran-2-yl)pyrrolidin-3-amine |
| SMILES | Cc1ccc(C2(C)C(N)CCN2C)o1 |
| InChI | InChI=1S/C11H18N2O/c1-8-4-5-10(14-8)11(2)9(12)6-7-13(11)3/h4-5,9H,6-7,12H2,1-3H3 |
| InChIKey | DLRKQOARECGESK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |