About 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol
4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol (PubChem CID 112709775) has the molecular formula C10H13NOS
and a molecular weight of 195.29 g/mol. Its IUPAC name is 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol.
Molecular Properties
| Compound Name | 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol |
| PubChem CID | 112709775 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol |
| SMILES | NCC1CCSc2cccc(O)c21 |
| InChI | InChI=1S/C10H13NOS/c11-6-7-4-5-13-9-3-1-2-8(12)10(7)9/h1-3,7,12H,4-6,11H2 |
| InChIKey | QINQAXCFOOUUBD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol?
The IUPAC name of 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol (CID 112709775) is 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol.
What is the SMILES notation for 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol?
The canonical SMILES for 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol is NCC1CCSc2cccc(O)c21.
What is the InChIKey of 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol?
The InChIKey is QINQAXCFOOUUBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NOS/c11-6-7-4-5-13-9-3-1-2-8(12)10(7)9/h1-3,7,12H,4-6,11H2.
What are the key properties of 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol?
4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol has a molecular weight of 195.29 g/mol, XLogP of 1.93, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-3,4-dihydro-2H-thiochromen-5-ol is sourced from PubChem (CID 112709775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).