C12H19N3 — CID 112709940
N'-(5,6,7,8-tetrahydroisoquinolin-3-yl)propane-1,3-diamine (PubChem CID 112709940) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is N'-(5,6,7,8-tetrahydroisoquinolin-3-yl)propane-1,3-diamine.
| Compound Name | N'-(5,6,7,8-tetrahydroisoquinolin-3-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 112709940 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N'-(5,6,7,8-tetrahydroisoquinolin-3-yl)propane-1,3-diamine |
| SMILES | NCCCNc1cc2c(cn1)CCCC2 |
| InChI | InChI=1S/C12H19N3/c13-6-3-7-14-12-8-10-4-1-2-5-11(10)9-15-12/h8-9H,1-7,13H2,(H,14,15) |
| InChIKey | MXMXGCKIZDAYEG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|