C21H30INO2 — CID 11271002
(2R)-2-[(2S)-1-[(E)-2-iodo-4-methylpent-2-enyl]piperidin-2-yl]-2-phenylmethoxypropanal (PubChem CID 11271002) has the molecular formula C21H30INO2 and a molecular weight of 455.38 g/mol. Its IUPAC name is (2R)-2-[(2S)-1-[(E)-2-iodo-4-methylpent-2-enyl]piperidin-2-yl]-2-phenylmethoxypropanal.
| Compound Name | (2R)-2-[(2S)-1-[(E)-2-iodo-4-methylpent-2-enyl]piperidin-2-yl]-2-phenylmethoxypropanal |
|---|---|
| PubChem CID | 11271002 |
| Molecular Formula | C21H30INO2 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (2R)-2-[(2S)-1-[(E)-2-iodo-4-methylpent-2-enyl]piperidin-2-yl]-2-phenylmethoxypropanal |
| SMILES | CC(C)/C=C(/I)CN1CCCC[C@H]1[C@](C)(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H30INO2/c1-17(2)13-19(22)14-23-12-8-7-11-20(23)21(3,16-24)25-15-18-9-5-4-6-10-18/h4-6,9-10,13,16-17,20H,7-8,11-12,14-15H2,1-3H3/b19-13+/t20-,21-/m0/s1 |
| InChIKey | CMIGHDZZXFJYIL-YBUCYZLGSA-N |
| XLogP | 4.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|