About 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine
1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine (PubChem CID 112710151) has the molecular formula C11H16N2S
and a molecular weight of 208.33 g/mol. Its IUPAC name is 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine.
Molecular Properties
| Compound Name | 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine |
| PubChem CID | 112710151 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine |
| SMILES | CN1CCC(N)C12CCc1sccc12 |
| InChI | InChI=1S/C11H16N2S/c1-13-6-3-10(12)11(13)5-2-9-8(11)4-7-14-9/h4,7,10H,2-3,5-6,12H2,1H3 |
| InChIKey | WDGKWORTTFCKIO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine?
The IUPAC name of 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine (CID 112710151) is 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine.
What is the SMILES notation for 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine?
The canonical SMILES for 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine is CN1CCC(N)C12CCc1sccc12.
What is the InChIKey of 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine?
The InChIKey is WDGKWORTTFCKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2S/c1-13-6-3-10(12)11(13)5-2-9-8(11)4-7-14-9/h4,7,10H,2-3,5-6,12H2,1H3.
What are the key properties of 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine?
1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine has a molecular weight of 208.33 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methylspiro[5,6-dihydrocyclopenta[b]thiophene-4,2'-pyrrolidine]-3'-amine is sourced from PubChem (CID 112710151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).