C8H15N3O — CID 112710409
3-(1-amino-3-methylbutyl)-1,2-oxazol-5-amine (PubChem CID 112710409) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 3-(1-amino-3-methylbutyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(1-amino-3-methylbutyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 112710409 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 3-(1-amino-3-methylbutyl)-1,2-oxazol-5-amine |
| SMILES | CC(C)CC(N)c1cc(N)on1 |
| InChI | InChI=1S/C8H15N3O/c1-5(2)3-6(9)7-4-8(10)12-11-7/h4-6H,3,9-10H2,1-2H3 |
| InChIKey | ZLGUPENCENAUSR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |