C18H26F8O4 — CID 11271083
3-ethyl-3-[[6-[(3-ethyloxetan-3-yl)methoxy]-2,2,3,3,4,4,5,5-octafluorohexoxy]methyl]oxetane (PubChem CID 11271083) has the molecular formula C18H26F8O4 and a molecular weight of 458.39 g/mol. Its IUPAC name is 3-ethyl-3-[[6-[(3-ethyloxetan-3-yl)methoxy]-2,2,3,3,4,4,5,5-octafluorohexoxy]methyl]oxetane.
| Compound Name | 3-ethyl-3-[[6-[(3-ethyloxetan-3-yl)methoxy]-2,2,3,3,4,4,5,5-octafluorohexoxy]methyl]oxetane |
|---|---|
| PubChem CID | 11271083 |
| Molecular Formula | C18H26F8O4 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 3-ethyl-3-[[6-[(3-ethyloxetan-3-yl)methoxy]-2,2,3,3,4,4,5,5-octafluorohexoxy]methyl]oxetane |
| SMILES | CCC1(COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)COCC2(CC)COC2)COC1 |
| InChI | InChI=1S/C18H26F8O4/c1-3-13(5-27-6-13)9-29-11-15(19,20)17(23,24)18(25,26)16(21,22)12-30-10-14(4-2)7-28-8-14/h3-12H2,1-2H3 |
| InChIKey | YHPAMUSAWICJEZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|