About 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine
3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine (PubChem CID 112711213) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine |
| PubChem CID | 112711213 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine |
| SMILES | CNc1cc(NC)n(C(C)C)n1 |
| InChI | InChI=1S/C8H16N4/c1-6(2)12-8(10-4)5-7(9-3)11-12/h5-6,10H,1-4H3,(H,9,11) |
| InChIKey | PJAJAQHGARIKIT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine?
The IUPAC name of 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine (CID 112711213) is 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine.
What is the SMILES notation for 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine?
The canonical SMILES for 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine is CNc1cc(NC)n(C(C)C)n1.
What is the InChIKey of 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine?
The InChIKey is PJAJAQHGARIKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-6(2)12-8(10-4)5-7(9-3)11-12/h5-6,10H,1-4H3,(H,9,11).
What are the key properties of 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine?
3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine has a molecular weight of 168.24 g/mol, XLogP of 1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,5-N-dimethyl-1-propan-2-ylpyrazole-3,5-diamine is sourced from PubChem (CID 112711213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).