C10H18N4 — CID 112711497
1-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl)ethanamine (PubChem CID 112711497) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl)ethanamine.
| Compound Name | 1-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl)ethanamine |
|---|---|
| PubChem CID | 112711497 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl)ethanamine |
| SMILES | CCc1nnc2n1C(C(C)N)CCC2 |
| InChI | InChI=1S/C10H18N4/c1-3-9-12-13-10-6-4-5-8(7(2)11)14(9)10/h7-8H,3-6,11H2,1-2H3 |
| InChIKey | RNWTWSZNQMTHCD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |