About 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid
4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid (PubChem CID 112711602) has the molecular formula C7H7ClN2O3
and a molecular weight of 202.60 g/mol. Its IUPAC name is 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 112711602 |
| Molecular Formula | C7H7ClN2O3 |
| Molecular Weight | 202.60 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1noc(NC2CC2)c1Cl |
| InChI | InChI=1S/C7H7ClN2O3/c8-4-5(7(11)12)10-13-6(4)9-3-1-2-3/h3,9H,1-2H2,(H,11,12) |
| InChIKey | XWYFATMNAJBBLY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.60 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid (CID 112711602) is 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid is O=C(O)c1noc(NC2CC2)c1Cl.
What is the InChIKey of 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid?
The InChIKey is XWYFATMNAJBBLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O3/c8-4-5(7(11)12)10-13-6(4)9-3-1-2-3/h3,9H,1-2H2,(H,11,12).
What are the key properties of 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid?
4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid has a molecular weight of 202.60 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(cyclopropylamino)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 112711602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).