C18H15BrF3NO3S — CID 11271173
(9S)-9-[3-bromo-4-(trifluoromethyl)phenyl]-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 11271173) has the molecular formula C18H15BrF3NO3S and a molecular weight of 462.29 g/mol. Its IUPAC name is (9S)-9-[3-bromo-4-(trifluoromethyl)phenyl]-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | (9S)-9-[3-bromo-4-(trifluoromethyl)phenyl]-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 11271173 |
| Molecular Formula | C18H15BrF3NO3S |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | (9S)-9-[3-bromo-4-(trifluoromethyl)phenyl]-1,1-dioxo-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | O=C1CCCC2=C1[C@H](c1ccc(C(F)(F)F)c(Br)c1)C1=C(CCS1(=O)=O)N2 |
| InChI | InChI=1S/C18H15BrF3NO3S/c19-11-8-9(4-5-10(11)18(20,21)22)15-16-12(2-1-3-14(16)24)23-13-6-7-27(25,26)17(13)15/h4-5,8,15,23H,1-3,6-7H2/t15-/m0/s1 |
| InChIKey | OHJZHBKCJMQUIU-HNNXBMFYSA-N |
| XLogP | 4.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |