About 3a,7a-dihydro-1,2-benzoxazol-7-amine
3a,7a-dihydro-1,2-benzoxazol-7-amine (PubChem CID 112711836) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 3a,7a-dihydro-1,2-benzoxazol-7-amine.
Molecular Properties
| Compound Name | 3a,7a-dihydro-1,2-benzoxazol-7-amine |
| PubChem CID | 112711836 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 3a,7a-dihydro-1,2-benzoxazol-7-amine |
| SMILES | NC1=CC=CC2C=NOC12 |
| InChI | InChI=1S/C7H8N2O/c8-6-3-1-2-5-4-9-10-7(5)6/h1-5,7H,8H2 |
| InChIKey | TUDIIMRRMVIMDB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3a,7a-dihydro-1,2-benzoxazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,7a-dihydro-1,2-benzoxazol-7-amine?
The IUPAC name of 3a,7a-dihydro-1,2-benzoxazol-7-amine (CID 112711836) is 3a,7a-dihydro-1,2-benzoxazol-7-amine.
What is the SMILES notation for 3a,7a-dihydro-1,2-benzoxazol-7-amine?
The canonical SMILES for 3a,7a-dihydro-1,2-benzoxazol-7-amine is NC1=CC=CC2C=NOC12.
What is the InChIKey of 3a,7a-dihydro-1,2-benzoxazol-7-amine?
The InChIKey is TUDIIMRRMVIMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c8-6-3-1-2-5-4-9-10-7(5)6/h1-5,7H,8H2.
What are the key properties of 3a,7a-dihydro-1,2-benzoxazol-7-amine?
3a,7a-dihydro-1,2-benzoxazol-7-amine has a molecular weight of 136.15 g/mol, XLogP of 0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,7a-dihydro-1,2-benzoxazol-7-amine is sourced from PubChem (CID 112711836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).