About 1-methyl-3a,7a-dihydroindazol-7-amine
1-methyl-3a,7a-dihydroindazol-7-amine (PubChem CID 112711871) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 1-methyl-3a,7a-dihydroindazol-7-amine.
Molecular Properties
| Compound Name | 1-methyl-3a,7a-dihydroindazol-7-amine |
| PubChem CID | 112711871 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1-methyl-3a,7a-dihydroindazol-7-amine |
| SMILES | CN1N=CC2C=CC=C(N)C21 |
| InChI | InChI=1S/C8H11N3/c1-11-8-6(5-10-11)3-2-4-7(8)9/h2-6,8H,9H2,1H3 |
| InChIKey | NTKPHHBEAHDSKA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3a,7a-dihydroindazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3a,7a-dihydroindazol-7-amine?
The IUPAC name of 1-methyl-3a,7a-dihydroindazol-7-amine (CID 112711871) is 1-methyl-3a,7a-dihydroindazol-7-amine.
What is the SMILES notation for 1-methyl-3a,7a-dihydroindazol-7-amine?
The canonical SMILES for 1-methyl-3a,7a-dihydroindazol-7-amine is CN1N=CC2C=CC=C(N)C21.
What is the InChIKey of 1-methyl-3a,7a-dihydroindazol-7-amine?
The InChIKey is NTKPHHBEAHDSKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-11-8-6(5-10-11)3-2-4-7(8)9/h2-6,8H,9H2,1H3.
What are the key properties of 1-methyl-3a,7a-dihydroindazol-7-amine?
1-methyl-3a,7a-dihydroindazol-7-amine has a molecular weight of 149.20 g/mol, XLogP of 0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3a,7a-dihydroindazol-7-amine is sourced from PubChem (CID 112711871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).