About 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide
2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide (PubChem CID 112712079) has the molecular formula C6H10N4O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide |
| PubChem CID | 112712079 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide |
| SMILES | CN(C)c1ncc(/C(N)=N\O)o1 |
| InChI | InChI=1S/C6H10N4O2/c1-10(2)6-8-3-4(12-6)5(7)9-11/h3,11H,1-2H3,(H2,7,9) |
| InChIKey | KTKBWWOSOZLSMB-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide?
The IUPAC name of 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide (CID 112712079) is 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide.
What is the SMILES notation for 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide?
The canonical SMILES for 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide is CN(C)c1ncc(/C(N)=N\O)o1.
What is the InChIKey of 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide?
The InChIKey is KTKBWWOSOZLSMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2/c1-10(2)6-8-3-4(12-6)5(7)9-11/h3,11H,1-2H3,(H2,7,9).
What are the key properties of 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide?
2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide has a molecular weight of 170.17 g/mol, XLogP of -0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N'-hydroxy-1,3-oxazole-5-carboximidamide is sourced from PubChem (CID 112712079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).