About 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one
1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one (PubChem CID 112712090) has the molecular formula C6H7ClN2O2
and a molecular weight of 174.59 g/mol. Its IUPAC name is 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one |
| PubChem CID | 112712090 |
| Molecular Formula | C6H7ClN2O2 |
| Molecular Weight | 174.59 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one |
| SMILES | CC(=O)Cc1oc(N)nc1Cl |
| InChI | InChI=1S/C6H7ClN2O2/c1-3(10)2-4-5(7)9-6(8)11-4/h2H2,1H3,(H2,8,9) |
| InChIKey | KKVBMDUDBAHMFA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.59 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one?
The IUPAC name of 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one (CID 112712090) is 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one.
What is the SMILES notation for 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one?
The canonical SMILES for 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one is CC(=O)Cc1oc(N)nc1Cl.
What is the InChIKey of 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one?
The InChIKey is KKVBMDUDBAHMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2/c1-3(10)2-4-5(7)9-6(8)11-4/h2H2,1H3,(H2,8,9).
What are the key properties of 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one?
1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one has a molecular weight of 174.59 g/mol, XLogP of 1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-4-chloro-1,3-oxazol-5-yl)propan-2-one is sourced from PubChem (CID 112712090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).