C9H12N2O2 — CID 112712305
1-(3a,7a-dihydro-1,2-benzoxazol-4-yl)-2-aminoethanol (PubChem CID 112712305) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-(3a,7a-dihydro-1,2-benzoxazol-4-yl)-2-aminoethanol.
| Compound Name | 1-(3a,7a-dihydro-1,2-benzoxazol-4-yl)-2-aminoethanol |
|---|---|
| PubChem CID | 112712305 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-(3a,7a-dihydro-1,2-benzoxazol-4-yl)-2-aminoethanol |
| SMILES | NCC(O)C1=CC=CC2ON=CC12 |
| InChI | InChI=1S/C9H12N2O2/c10-4-8(12)6-2-1-3-9-7(6)5-11-13-9/h1-3,5,7-9,12H,4,10H2 |
| InChIKey | BUFPPLUIYXMQIL-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |